C14H20F2O3 — CID 58225798
[3-(hydroxymethyl)-1-adamantyl]methyl 2,2-difluoroacetate (PubChem CID 58225798) has the molecular formula C14H20F2O3 and a molecular weight of 274.31 g/mol. Its IUPAC name is [3-(hydroxymethyl)-1-adamantyl]methyl 2,2-difluoroacetate.
| Compound Name | [3-(hydroxymethyl)-1-adamantyl]methyl 2,2-difluoroacetate |
|---|---|
| PubChem CID | 58225798 |
| Molecular Formula | C14H20F2O3 |
| Molecular Weight | 274.31 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | [3-(hydroxymethyl)-1-adamantyl]methyl 2,2-difluoroacetate |
| SMILES | O=C(OCC12CC3CC(CC(CO)(C3)C1)C2)C(F)F |
| InChI | InChI=1S/C14H20F2O3/c15-11(16)12(18)19-8-14-4-9-1-10(5-14)3-13(2-9,6-14)7-17/h9-11,17H,1-8H2 |
| InChIKey | NMCOJLRPHPJRGR-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.31 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |