About 1-adamantylmethyl 2-(2-chloroacetyl)oxyacetate
1-adamantylmethyl 2-(2-chloroacetyl)oxyacetate (PubChem CID 58106016) has the molecular formula C15H21ClO4
and a molecular weight of 300.78 g/mol. Its IUPAC name is 1-adamantylmethyl 2-(2-chloroacetyl)oxyacetate.
Molecular Properties
| Compound Name | 1-adamantylmethyl 2-(2-chloroacetyl)oxyacetate |
| PubChem CID | 58106016 |
| Molecular Formula | C15H21ClO4 |
| Molecular Weight | 300.78 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | 1-adamantylmethyl 2-(2-chloroacetyl)oxyacetate |
| SMILES | O=C(CCl)OCC(=O)OCC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C15H21ClO4/c16-7-13(17)19-8-14(18)20-9-15-4-10-1-11(5-15)3-12(2-10)6-15/h10-12H,1-9H2 |
| InChIKey | DQYOCDCTCXCFFS-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.78 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-adamantylmethyl 2-(2-chloroacetyl)oxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-adamantylmethyl 2-(2-chloroacetyl)oxyacetate?
The IUPAC name of 1-adamantylmethyl 2-(2-chloroacetyl)oxyacetate (CID 58106016) is 1-adamantylmethyl 2-(2-chloroacetyl)oxyacetate.
What is the SMILES notation for 1-adamantylmethyl 2-(2-chloroacetyl)oxyacetate?
The canonical SMILES for 1-adamantylmethyl 2-(2-chloroacetyl)oxyacetate is O=C(CCl)OCC(=O)OCC12CC3CC(CC(C3)C1)C2.
What is the InChIKey of 1-adamantylmethyl 2-(2-chloroacetyl)oxyacetate?
The InChIKey is DQYOCDCTCXCFFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21ClO4/c16-7-13(17)19-8-14(18)20-9-15-4-10-1-11(5-15)3-12(2-10)6-15/h10-12H,1-9H2.
What are the key properties of 1-adamantylmethyl 2-(2-chloroacetyl)oxyacetate?
1-adamantylmethyl 2-(2-chloroacetyl)oxyacetate has a molecular weight of 300.78 g/mol, XLogP of 2.53, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-adamantylmethyl 2-(2-chloroacetyl)oxyacetate is sourced from PubChem (CID 58106016), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).