C12H18O — CID 163953655
[(8R)-6-tetracyclo[4.3.1.11,4.02,8]undecanyl]methanol (PubChem CID 163953655) has the molecular formula C12H18O and a molecular weight of 178.27 g/mol. Its IUPAC name is [(8R)-6-tetracyclo[4.3.1.11,4.02,8]undecanyl]methanol.
| Compound Name | [(8R)-6-tetracyclo[4.3.1.11,4.02,8]undecanyl]methanol |
|---|---|
| PubChem CID | 163953655 |
| Molecular Formula | C12H18O |
| Molecular Weight | 178.27 g/mol |
| Exact Mass | 178.14 |
| IUPAC Name | [(8R)-6-tetracyclo[4.3.1.11,4.02,8]undecanyl]methanol |
| SMILES | OCC12CC3CC4[C@@H](C1)CC4(C3)C2 |
| InChI | InChI=1S/C12H18O/c13-7-11-2-8-1-10-9(4-11)5-12(10,3-8)6-11/h8-10,13H,1-7H2/t8?,9-,10?,11?,12?/m0/s1 |
| InChIKey | SBMVSQROUOJBCC-GDDZGCMGSA-N |
| XLogP | 2.20 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.27 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |