C17H22F3NO3 — CID 119354640
1-[3-(trifluoromethyl)adamantane-1-carbonyl]pyrrolidine-3-carboxylic acid (PubChem CID 119354640) has the molecular formula C17H22F3NO3 and a molecular weight of 345.36 g/mol. Its IUPAC name is 1-[3-(trifluoromethyl)adamantane-1-carbonyl]pyrrolidine-3-carboxylic acid.
| Compound Name | 1-[3-(trifluoromethyl)adamantane-1-carbonyl]pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 119354640 |
| Molecular Formula | C17H22F3NO3 |
| Molecular Weight | 345.36 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | 1-[3-(trifluoromethyl)adamantane-1-carbonyl]pyrrolidine-3-carboxylic acid |
| SMILES | O=C(O)C1CCN(C(=O)C23CC4CC(C2)CC(C(F)(F)F)(C4)C3)C1 |
| InChI | InChI=1S/C17H22F3NO3/c18-17(19,20)16-6-10-3-11(7-16)5-15(4-10,9-16)14(24)21-2-1-12(8-21)13(22)23/h10-12H,1-9H2,(H,22,23) |
| InChIKey | NLFLUEFMRPEPPQ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.36 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |