C4H3F9O6S4 — CID 175721690
bis(trifluoromethylsulfonyl)methylsulfonyl-trifluoromethane;sulfane (PubChem CID 175721690) has the molecular formula C4H3F9O6S4 and a molecular weight of 446.31 g/mol. Its IUPAC name is bis(trifluoromethylsulfonyl)methylsulfonyl-trifluoromethane;sulfane.
| Compound Name | bis(trifluoromethylsulfonyl)methylsulfonyl-trifluoromethane;sulfane |
|---|---|
| PubChem CID | 175721690 |
| Molecular Formula | C4H3F9O6S4 |
| Molecular Weight | 446.31 g/mol |
| Exact Mass | 445.87 |
| IUPAC Name | bis(trifluoromethylsulfonyl)methylsulfonyl-trifluoromethane;sulfane |
| SMILES | O=S(=O)(C(S(=O)(=O)C(F)(F)F)S(=O)(=O)C(F)(F)F)C(F)(F)F.S |
| InChI | InChI=1S/C4HF9O6S3.H2S/c5-2(6,7)20(14,15)1(21(16,17)3(8,9)10)22(18,19)4(11,12)13;/h1H;1H2 |
| InChIKey | KVFIROGEOMKPRQ-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 102.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.31 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |