C5H6F6O6S3 — CID 89277222
1-[bis(trifluoromethylsulfonyl)methylsulfonyl]ethane (PubChem CID 89277222) has the molecular formula C5H6F6O6S3 and a molecular weight of 372.29 g/mol. Its IUPAC name is 1-[bis(trifluoromethylsulfonyl)methylsulfonyl]ethane.
| Compound Name | 1-[bis(trifluoromethylsulfonyl)methylsulfonyl]ethane |
|---|---|
| PubChem CID | 89277222 |
| Molecular Formula | C5H6F6O6S3 |
| Molecular Weight | 372.29 g/mol |
| Exact Mass | 371.92 |
| IUPAC Name | 1-[bis(trifluoromethylsulfonyl)methylsulfonyl]ethane |
| SMILES | CCS(=O)(=O)C(S(=O)(=O)C(F)(F)F)S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C5H6F6O6S3/c1-2-18(12,13)3(19(14,15)4(6,7)8)20(16,17)5(9,10)11/h3H,2H2,1H3 |
| InChIKey | NGEWHKMUCBSCTD-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 102.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.29 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |