C5H5F7O4S2 — CID 139244935
3-fluoro-1,1-bis(trifluoromethylsulfonyl)propane (PubChem CID 139244935) has the molecular formula C5H5F7O4S2 and a molecular weight of 326.21 g/mol. Its IUPAC name is 3-fluoro-1,1-bis(trifluoromethylsulfonyl)propane.
| Compound Name | 3-fluoro-1,1-bis(trifluoromethylsulfonyl)propane |
|---|---|
| PubChem CID | 139244935 |
| Molecular Formula | C5H5F7O4S2 |
| Molecular Weight | 326.21 g/mol |
| Exact Mass | 325.95 |
| IUPAC Name | 3-fluoro-1,1-bis(trifluoromethylsulfonyl)propane |
| SMILES | O=S(=O)(C(CCF)S(=O)(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C5H5F7O4S2/c6-2-1-3(17(13,14)4(7,8)9)18(15,16)5(10,11)12/h3H,1-2H2 |
| InChIKey | UICPJEXVWNYMGQ-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.21 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |