C7H5ClF12O8S4 — CID 89179091
1,1-bis(trifluoromethylsulfonyl)ethane;[chloro(trifluoromethylsulfonyl)methyl]sulfonyl-trifluoromethane (PubChem CID 89179091) has the molecular formula C7H5ClF12O8S4 and a molecular weight of 608.81 g/mol. Its IUPAC name is 1,1-bis(trifluoromethylsulfonyl)ethane;[chloro(trifluoromethylsulfonyl)methyl]sulfonyl-trifluoromethane.
| Compound Name | 1,1-bis(trifluoromethylsulfonyl)ethane;[chloro(trifluoromethylsulfonyl)methyl]sulfonyl-trifluoromethane |
|---|---|
| PubChem CID | 89179091 |
| Molecular Formula | C7H5ClF12O8S4 |
| Molecular Weight | 608.81 g/mol |
| Exact Mass | 607.84 |
| IUPAC Name | 1,1-bis(trifluoromethylsulfonyl)ethane;[chloro(trifluoromethylsulfonyl)methyl]sulfonyl-trifluoromethane |
| SMILES | CC(S(=O)(=O)C(F)(F)F)S(=O)(=O)C(F)(F)F.O=S(=O)(C(Cl)S(=O)(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C4H4F6O4S2.C3HClF6O4S2/c1-2(15(11,12)3(5,6)7)16(13,14)4(8,9)10;4-1(15(11,12)2(5,6)7)16(13,14)3(8,9)10/h2H,1H3;1H |
| InChIKey | PEIWSIPRMNTSNA-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 136.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.81 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|