C9H8F9FeO6S3+ — CID 162061609
bis(trifluoromethylsulfonyl)methylsulfonyl-trifluoromethane;iron(2+);penta-1,3-diene (PubChem CID 162061609) has the molecular formula C9H8F9FeO6S3+ and a molecular weight of 535.19 g/mol. Its IUPAC name is bis(trifluoromethylsulfonyl)methylsulfonyl-trifluoromethane;iron(2+);penta-1,3-diene.
| Compound Name | bis(trifluoromethylsulfonyl)methylsulfonyl-trifluoromethane;iron(2+);penta-1,3-diene |
|---|---|
| PubChem CID | 162061609 |
| Molecular Formula | C9H8F9FeO6S3+ |
| Molecular Weight | 535.19 g/mol |
| Exact Mass | 534.87 |
| IUPAC Name | bis(trifluoromethylsulfonyl)methylsulfonyl-trifluoromethane;iron(2+);penta-1,3-diene |
| SMILES | O=S(=O)(C(S(=O)(=O)C(F)(F)F)S(=O)(=O)C(F)(F)F)C(F)(F)F.[Fe+2].[H]/[C-]=C\C=CC |
| InChI | InChI=1S/C5H7.C4HF9O6S3.Fe/c1-3-5-4-2;5-2(6,7)20(14,15)1(21(16,17)3(8,9)10)22(18,19)4(11,12)13;/h1,3-5H,2H3;1H;/q-1;;+2 |
| InChIKey | HWHRLYQFTQEDSZ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 102.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.19 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|