About methyl trifluoromethanesulfonate;penta-1,3-diene;zirconium
methyl trifluoromethanesulfonate;penta-1,3-diene;zirconium (PubChem CID 160569225) has the molecular formula C7H10F3O3SZr-
and a molecular weight of 322.44 g/mol. Its IUPAC name is methyl trifluoromethanesulfonate;penta-1,3-diene;zirconium.
Molecular Properties
| Compound Name | methyl trifluoromethanesulfonate;penta-1,3-diene;zirconium |
| PubChem CID | 160569225 |
| Molecular Formula | C7H10F3O3SZr- |
| Molecular Weight | 322.44 g/mol |
| Exact Mass | 320.94 |
| IUPAC Name | methyl trifluoromethanesulfonate;penta-1,3-diene;zirconium |
| SMILES | COS(=O)(=O)C(F)(F)F.[H]/[C-]=C\C=CC.[Zr] |
| InChI | InChI=1S/C5H7.C2H3F3O3S.Zr/c1-3-5-4-2;1-8-9(6,7)2(3,4)5;/h1,3-5H,2H3;1H3;/q-1;; |
| InChIKey | TVJYGMDSJONLOZ-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.44 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze methyl trifluoromethanesulfonate;penta-1,3-diene;zirconium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl trifluoromethanesulfonate;penta-1,3-diene;zirconium?
The IUPAC name of methyl trifluoromethanesulfonate;penta-1,3-diene;zirconium (CID 160569225) is methyl trifluoromethanesulfonate;penta-1,3-diene;zirconium.
What is the SMILES notation for methyl trifluoromethanesulfonate;penta-1,3-diene;zirconium?
The canonical SMILES for methyl trifluoromethanesulfonate;penta-1,3-diene;zirconium is COS(=O)(=O)C(F)(F)F.[H]/[C-]=C\C=CC.[Zr].
What is the InChIKey of methyl trifluoromethanesulfonate;penta-1,3-diene;zirconium?
The InChIKey is TVJYGMDSJONLOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7.C2H3F3O3S.Zr/c1-3-5-4-2;1-8-9(6,7)2(3,4)5;/h1,3-5H,2H3;1H3;/q-1;;.
What are the key properties of methyl trifluoromethanesulfonate;penta-1,3-diene;zirconium?
methyl trifluoromethanesulfonate;penta-1,3-diene;zirconium has a molecular weight of 322.44 g/mol, XLogP of 2.03, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl trifluoromethanesulfonate;penta-1,3-diene;zirconium is sourced from PubChem (CID 160569225), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).