About methyl trifluoromethanesulfonate;trimethyloxidanium;hexafluorophosphate
methyl trifluoromethanesulfonate;trimethyloxidanium;hexafluorophosphate (PubChem CID 23466283) has the molecular formula C5H12F9O4PS
and a molecular weight of 370.17 g/mol. Its IUPAC name is methyl trifluoromethanesulfonate;trimethyloxidanium;hexafluorophosphate.
Molecular Properties
| Compound Name | methyl trifluoromethanesulfonate;trimethyloxidanium;hexafluorophosphate |
| PubChem CID | 23466283 |
| Molecular Formula | C5H12F9O4PS |
| Molecular Weight | 370.17 g/mol |
| Exact Mass | 370.01 |
| IUPAC Name | methyl trifluoromethanesulfonate;trimethyloxidanium;hexafluorophosphate |
| SMILES | COS(=O)(=O)C(F)(F)F.C[O+](C)C.F[P-](F)(F)(F)(F)F |
| InChI | InChI=1S/C3H9O.C2H3F3O3S.F6P/c1-4(2)3;1-8-9(6,7)2(3,4)5;1-7(2,3,4,5)6/h1-3H3;1H3;/q+1;;-1 |
| InChIKey | DVQJVMWOBZQGEN-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 46.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.17 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze methyl trifluoromethanesulfonate;trimethyloxidanium;hexafluorophosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl trifluoromethanesulfonate;trimethyloxidanium;hexafluorophosphate?
The IUPAC name of methyl trifluoromethanesulfonate;trimethyloxidanium;hexafluorophosphate (CID 23466283) is methyl trifluoromethanesulfonate;trimethyloxidanium;hexafluorophosphate.
What is the SMILES notation for methyl trifluoromethanesulfonate;trimethyloxidanium;hexafluorophosphate?
The canonical SMILES for methyl trifluoromethanesulfonate;trimethyloxidanium;hexafluorophosphate is COS(=O)(=O)C(F)(F)F.C[O+](C)C.F[P-](F)(F)(F)(F)F.
What is the InChIKey of methyl trifluoromethanesulfonate;trimethyloxidanium;hexafluorophosphate?
The InChIKey is DVQJVMWOBZQGEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H9O.C2H3F3O3S.F6P/c1-4(2)3;1-8-9(6,7)2(3,4)5;1-7(2,3,4,5)6/h1-3H3;1H3;/q+1;;-1.
What are the key properties of methyl trifluoromethanesulfonate;trimethyloxidanium;hexafluorophosphate?
methyl trifluoromethanesulfonate;trimethyloxidanium;hexafluorophosphate has a molecular weight of 370.17 g/mol, XLogP of 4.29, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl trifluoromethanesulfonate;trimethyloxidanium;hexafluorophosphate is sourced from PubChem (CID 23466283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).