C10H14F6N2O5S2 — CID 58195757
1-[4,4-bis(trifluoromethylsulfonyl)butan-2-yl]-3-prop-2-enylurea (PubChem CID 58195757) has the molecular formula C10H14F6N2O5S2 and a molecular weight of 420.35 g/mol. Its IUPAC name is 1-[4,4-bis(trifluoromethylsulfonyl)butan-2-yl]-3-prop-2-enylurea.
| Compound Name | 1-[4,4-bis(trifluoromethylsulfonyl)butan-2-yl]-3-prop-2-enylurea |
|---|---|
| PubChem CID | 58195757 |
| Molecular Formula | C10H14F6N2O5S2 |
| Molecular Weight | 420.35 g/mol |
| Exact Mass | 420.02 |
| IUPAC Name | 1-[4,4-bis(trifluoromethylsulfonyl)butan-2-yl]-3-prop-2-enylurea |
| SMILES | C=CCNC(=O)NC(C)CC(S(=O)(=O)C(F)(F)F)S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C10H14F6N2O5S2/c1-3-4-17-8(19)18-6(2)5-7(24(20,21)9(11,12)13)25(22,23)10(14,15)16/h3,6-7H,1,4-5H2,2H3,(H2,17,18,19) |
| InChIKey | UFZPBHNEAOFHME-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 109.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.35 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|