C17H22F6O6S2 — CID 58193480
[4-methyl-1,1-bis(trifluoromethylsulfonyl)pentan-3-yl] 2-(2-bicyclo[2.2.1]hept-5-enyl)acetate (PubChem CID 58193480) has the molecular formula C17H22F6O6S2 and a molecular weight of 500.48 g/mol. Its IUPAC name is [4-methyl-1,1-bis(trifluoromethylsulfonyl)pentan-3-yl] 2-(2-bicyclo[2.2.1]hept-5-enyl)acetate.
| Compound Name | [4-methyl-1,1-bis(trifluoromethylsulfonyl)pentan-3-yl] 2-(2-bicyclo[2.2.1]hept-5-enyl)acetate |
|---|---|
| PubChem CID | 58193480 |
| Molecular Formula | C17H22F6O6S2 |
| Molecular Weight | 500.48 g/mol |
| Exact Mass | 500.08 |
| IUPAC Name | [4-methyl-1,1-bis(trifluoromethylsulfonyl)pentan-3-yl] 2-(2-bicyclo[2.2.1]hept-5-enyl)acetate |
| SMILES | CC(C)C(CC(S(=O)(=O)C(F)(F)F)S(=O)(=O)C(F)(F)F)OC(=O)CC1CC2C=CC1C2 |
| InChI | InChI=1S/C17H22F6O6S2/c1-9(2)13(29-14(24)7-12-6-10-3-4-11(12)5-10)8-15(30(25,26)16(18,19)20)31(27,28)17(21,22)23/h3-4,9-13,15H,5-8H2,1-2H3 |
| InChIKey | PCCIZWRDXOIAEP-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 94.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.48 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|