C8H13ClF6O4S3 — CID 126660364
4,4-bis(trifluoromethylsulfonyl)butyl-chloro-dimethyl-λ4-sulfane (PubChem CID 126660364) has the molecular formula C8H13ClF6O4S3 and a molecular weight of 418.83 g/mol. Its IUPAC name is 4,4-bis(trifluoromethylsulfonyl)butyl-chloro-dimethyl-λ4-sulfane.
| Compound Name | 4,4-bis(trifluoromethylsulfonyl)butyl-chloro-dimethyl-λ4-sulfane |
|---|---|
| PubChem CID | 126660364 |
| Molecular Formula | C8H13ClF6O4S3 |
| Molecular Weight | 418.83 g/mol |
| Exact Mass | 417.96 |
| IUPAC Name | 4,4-bis(trifluoromethylsulfonyl)butyl-chloro-dimethyl-λ4-sulfane |
| SMILES | CS(C)(Cl)CCCC(S(=O)(=O)C(F)(F)F)S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C8H13ClF6O4S3/c1-20(2,9)5-3-4-6(21(16,17)7(10,11)12)22(18,19)8(13,14)15/h6H,3-5H2,1-2H3 |
| InChIKey | RLRMAOBRRUCOCW-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.83 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |