C6H11F3N2O3S2 — CID 22088496
(2S)-4-methylsulfanyl-2-(trifluoromethylsulfonylamino)butanamide (PubChem CID 22088496) has the molecular formula C6H11F3N2O3S2 and a molecular weight of 280.29 g/mol. Its IUPAC name is (2S)-4-methylsulfanyl-2-(trifluoromethylsulfonylamino)butanamide.
| Compound Name | (2S)-4-methylsulfanyl-2-(trifluoromethylsulfonylamino)butanamide |
|---|---|
| PubChem CID | 22088496 |
| Molecular Formula | C6H11F3N2O3S2 |
| Molecular Weight | 280.29 g/mol |
| Exact Mass | 280.02 |
| IUPAC Name | (2S)-4-methylsulfanyl-2-(trifluoromethylsulfonylamino)butanamide |
| SMILES | CSCC[C@H](NS(=O)(=O)C(F)(F)F)C(N)=O |
| InChI | InChI=1S/C6H11F3N2O3S2/c1-15-3-2-4(5(10)12)11-16(13,14)6(7,8)9/h4,11H,2-3H2,1H3,(H2,10,12)/t4-/m0/s1 |
| InChIKey | NMVOUCWEUVXTSU-BYPYZUCNSA-N |
| XLogP | 0.03 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.29 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |