C18H24N2O4S2 — CID 154866120
(2S)-4-methylsulfanyl-2-[(4-propan-2-yloxynaphthalen-1-yl)sulfonylamino]butanamide (PubChem CID 154866120) has the molecular formula C18H24N2O4S2 and a molecular weight of 396.53 g/mol. Its IUPAC name is (2S)-4-methylsulfanyl-2-[(4-propan-2-yloxynaphthalen-1-yl)sulfonylamino]butanamide.
| Compound Name | (2S)-4-methylsulfanyl-2-[(4-propan-2-yloxynaphthalen-1-yl)sulfonylamino]butanamide |
|---|---|
| PubChem CID | 154866120 |
| Molecular Formula | C18H24N2O4S2 |
| Molecular Weight | 396.53 g/mol |
| Exact Mass | 396.12 |
| IUPAC Name | (2S)-4-methylsulfanyl-2-[(4-propan-2-yloxynaphthalen-1-yl)sulfonylamino]butanamide |
| SMILES | CSCC[C@H](NS(=O)(=O)c1ccc(OC(C)C)c2ccccc12)C(N)=O |
| InChI | InChI=1S/C18H24N2O4S2/c1-12(2)24-16-8-9-17(14-7-5-4-6-13(14)16)26(22,23)20-15(18(19)21)10-11-25-3/h4-9,12,15,20H,10-11H2,1-3H3,(H2,19,21)/t15-/m0/s1 |
| InChIKey | GGQQHIZJTCMMIL-HNNXBMFYSA-N |
| XLogP | 2.51 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.53 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |