C6H13NO5S2 — CID 57211118
2,2-bis(ethylsulfonyl)acetamide (PubChem CID 57211118) has the molecular formula C6H13NO5S2 and a molecular weight of 243.31 g/mol. Its IUPAC name is 2,2-bis(ethylsulfonyl)acetamide.
| Compound Name | 2,2-bis(ethylsulfonyl)acetamide |
|---|---|
| PubChem CID | 57211118 |
| Molecular Formula | C6H13NO5S2 |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.02 |
| IUPAC Name | 2,2-bis(ethylsulfonyl)acetamide |
| SMILES | CCS(=O)(=O)C(C(N)=O)S(=O)(=O)CC |
| InChI | InChI=1S/C6H13NO5S2/c1-3-13(9,10)6(5(7)8)14(11,12)4-2/h6H,3-4H2,1-2H3,(H2,7,8) |
| InChIKey | DHBOIKKTFAUCRE-UHFFFAOYSA-N |
| XLogP | -1.33 |
| TPSA | 111.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |