C6H11F3N2O — CID 166839433
(2S)-2-amino-4,4,4-trifluoro-3,3-dimethylbutanamide (PubChem CID 166839433) has the molecular formula C6H11F3N2O and a molecular weight of 184.16 g/mol. Its IUPAC name is (2S)-2-amino-4,4,4-trifluoro-3,3-dimethylbutanamide.
| Compound Name | (2S)-2-amino-4,4,4-trifluoro-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 166839433 |
| Molecular Formula | C6H11F3N2O |
| Molecular Weight | 184.16 g/mol |
| Exact Mass | 184.08 |
| IUPAC Name | (2S)-2-amino-4,4,4-trifluoro-3,3-dimethylbutanamide |
| SMILES | CC(C)([C@H](N)C(N)=O)C(F)(F)F |
| InChI | InChI=1S/C6H11F3N2O/c1-5(2,6(7,8)9)3(10)4(11)12/h3H,10H2,1-2H3,(H2,11,12)/t3-/m1/s1 |
| InChIKey | ZEOYSYRWSIYRCH-GSVOUGTGSA-N |
| XLogP | 0.39 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.16 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |