C21H14F18O3 — CID 161340983
bis(1,1,1,3,3,3-hexafluoro-2-phenylpropan-2-ol);1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 161340983) has the molecular formula C21H14F18O3 and a molecular weight of 656.30 g/mol. Its IUPAC name is bis(1,1,1,3,3,3-hexafluoro-2-phenylpropan-2-ol);1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | bis(1,1,1,3,3,3-hexafluoro-2-phenylpropan-2-ol);1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 161340983 |
| Molecular Formula | C21H14F18O3 |
| Molecular Weight | 656.30 g/mol |
| Exact Mass | 656.07 |
| IUPAC Name | bis(1,1,1,3,3,3-hexafluoro-2-phenylpropan-2-ol);1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | OC(C(F)(F)F)C(F)(F)F.OC(c1ccccc1)(C(F)(F)F)C(F)(F)F.OC(c1ccccc1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/2C9H6F6O.C3H2F6O/c2*10-8(11,12)7(16,9(13,14)15)6-4-2-1-3-5-6;4-2(5,6)1(10)3(7,8)9/h2*1-5,16H;1,10H |
| InChIKey | VMQSXSURSBOPDV-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.30 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |