C6F10O4S — CID 178076277
1,1,1,3,3-pentafluoro-3-(1,1,3,3,3-pentafluoro-2-oxopropyl)sulfonylpropan-2-one (PubChem CID 178076277) has the molecular formula C6F10O4S and a molecular weight of 358.11 g/mol. Its IUPAC name is 1,1,1,3,3-pentafluoro-3-(1,1,3,3,3-pentafluoro-2-oxopropyl)sulfonylpropan-2-one.
| Compound Name | 1,1,1,3,3-pentafluoro-3-(1,1,3,3,3-pentafluoro-2-oxopropyl)sulfonylpropan-2-one |
|---|---|
| PubChem CID | 178076277 |
| Molecular Formula | C6F10O4S |
| Molecular Weight | 358.11 g/mol |
| Exact Mass | 357.94 |
| IUPAC Name | 1,1,1,3,3-pentafluoro-3-(1,1,3,3,3-pentafluoro-2-oxopropyl)sulfonylpropan-2-one |
| SMILES | O=C(C(F)(F)F)C(F)(F)S(=O)(=O)C(F)(F)C(=O)C(F)(F)F |
| InChI | InChI=1S/C6F10O4S/c7-3(8,9)1(17)5(13,14)21(19,20)6(15,16)2(18)4(10,11)12 |
| InChIKey | SOBDVBLKGAPYRT-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.11 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |