About lithium;deuterio prop-2-ynoate;hydride
lithium;deuterio prop-2-ynoate;hydride (PubChem CID 174455819) has the molecular formula C3H3LiO2
and a molecular weight of 79.00 g/mol. Its IUPAC name is lithium;deuterio prop-2-ynoate;hydride.
Molecular Properties
| Compound Name | lithium;deuterio prop-2-ynoate;hydride |
| PubChem CID | 174455819 |
| Molecular Formula | C3H3LiO2 |
| Molecular Weight | 79.00 g/mol |
| Exact Mass | 79.04 |
| IUPAC Name | lithium;deuterio prop-2-ynoate;hydride |
| SMILES | [2H]OC(=O)C#C.[H-].[Li+] |
| InChI | InChI=1S/C3H2O2.Li.H/c1-2-3(4)5;;/h1H,(H,4,5);;/q;+1;-1/i/hD |
| InChIKey | MIJMFPFWUULCNM-DYCDLGHISA-N |
| XLogP | -3.18 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 79.00 |
| LogP ≤ 5 | -3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze lithium;deuterio prop-2-ynoate;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;deuterio prop-2-ynoate;hydride?
The IUPAC name of lithium;deuterio prop-2-ynoate;hydride (CID 174455819) is lithium;deuterio prop-2-ynoate;hydride.
What is the SMILES notation for lithium;deuterio prop-2-ynoate;hydride?
The canonical SMILES for lithium;deuterio prop-2-ynoate;hydride is [2H]OC(=O)C#C.[H-].[Li+].
What is the InChIKey of lithium;deuterio prop-2-ynoate;hydride?
The InChIKey is MIJMFPFWUULCNM-DYCDLGHISA-N. The full InChI is InChI=1S/C3H2O2.Li.H/c1-2-3(4)5;;/h1H,(H,4,5);;/q;+1;-1/i/hD.
What are the key properties of lithium;deuterio prop-2-ynoate;hydride?
lithium;deuterio prop-2-ynoate;hydride has a molecular weight of 79.00 g/mol, XLogP of -3.18, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;deuterio prop-2-ynoate;hydride is sourced from PubChem (CID 174455819), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).