About potassium;hydride;phosphanylurea
potassium;hydride;phosphanylurea (PubChem CID 174264312) has the molecular formula CH6KN2OP
and a molecular weight of 132.14 g/mol. Its IUPAC name is potassium;hydride;phosphanylurea.
Molecular Properties
| Compound Name | potassium;hydride;phosphanylurea |
| PubChem CID | 174264312 |
| Molecular Formula | CH6KN2OP |
| Molecular Weight | 132.14 g/mol |
| Exact Mass | 131.99 |
| IUPAC Name | potassium;hydride;phosphanylurea |
| SMILES | NC(=O)NP.[H-].[K+] |
| InChI | InChI=1S/CH5N2OP.K.H/c2-1(4)3-5;;/h5H2,(H3,2,3,4);;/q;+1;-1 |
| InChIKey | CZYXDFVYAMTUKT-UHFFFAOYSA-N |
| XLogP | -3.44 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.14 |
| LogP ≤ 5 | -3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze potassium;hydride;phosphanylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;hydride;phosphanylurea?
The IUPAC name of potassium;hydride;phosphanylurea (CID 174264312) is potassium;hydride;phosphanylurea.
What is the SMILES notation for potassium;hydride;phosphanylurea?
The canonical SMILES for potassium;hydride;phosphanylurea is NC(=O)NP.[H-].[K+].
What is the InChIKey of potassium;hydride;phosphanylurea?
The InChIKey is CZYXDFVYAMTUKT-UHFFFAOYSA-N. The full InChI is InChI=1S/CH5N2OP.K.H/c2-1(4)3-5;;/h5H2,(H3,2,3,4);;/q;+1;-1.
What are the key properties of potassium;hydride;phosphanylurea?
potassium;hydride;phosphanylurea has a molecular weight of 132.14 g/mol, XLogP of -3.44, 0 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;hydride;phosphanylurea is sourced from PubChem (CID 174264312), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).