About potassium;amino(oxo)methanesulfonic acid;hydride
potassium;amino(oxo)methanesulfonic acid;hydride (PubChem CID 173000398) has the molecular formula CH4KNO4S
and a molecular weight of 165.21 g/mol. Its IUPAC name is potassium;amino(oxo)methanesulfonic acid;hydride.
Molecular Properties
| Compound Name | potassium;amino(oxo)methanesulfonic acid;hydride |
| PubChem CID | 173000398 |
| Molecular Formula | CH4KNO4S |
| Molecular Weight | 165.21 g/mol |
| Exact Mass | 164.95 |
| IUPAC Name | potassium;amino(oxo)methanesulfonic acid;hydride |
| SMILES | NC(=O)S(=O)(=O)O.[H-].[K+] |
| InChI | InChI=1S/CH3NO4S.K.H/c2-1(3)7(4,5)6;;/h(H2,2,3)(H,4,5,6);;/q;+1;-1 |
| InChIKey | HAMCQNIEYZBPIG-UHFFFAOYSA-N |
| XLogP | -3.93 |
| TPSA | 97.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.21 |
| LogP ≤ 5 | -3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze potassium;amino(oxo)methanesulfonic acid;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;amino(oxo)methanesulfonic acid;hydride?
The IUPAC name of potassium;amino(oxo)methanesulfonic acid;hydride (CID 173000398) is potassium;amino(oxo)methanesulfonic acid;hydride.
What is the SMILES notation for potassium;amino(oxo)methanesulfonic acid;hydride?
The canonical SMILES for potassium;amino(oxo)methanesulfonic acid;hydride is NC(=O)S(=O)(=O)O.[H-].[K+].
What is the InChIKey of potassium;amino(oxo)methanesulfonic acid;hydride?
The InChIKey is HAMCQNIEYZBPIG-UHFFFAOYSA-N. The full InChI is InChI=1S/CH3NO4S.K.H/c2-1(3)7(4,5)6;;/h(H2,2,3)(H,4,5,6);;/q;+1;-1.
What are the key properties of potassium;amino(oxo)methanesulfonic acid;hydride?
potassium;amino(oxo)methanesulfonic acid;hydride has a molecular weight of 165.21 g/mol, XLogP of -3.93, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;amino(oxo)methanesulfonic acid;hydride is sourced from PubChem (CID 173000398), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).