C20H20F6N10O8S2 — CID 165363604
1-(N-carbamoylcarbamimidoyl)-3-[2-(trifluoromethyl)phenyl]sulfonylurea (PubChem CID 165363604) has the molecular formula C20H20F6N10O8S2 and a molecular weight of 706.56 g/mol. Its IUPAC name is 1-(N-carbamoylcarbamimidoyl)-3-[2-(trifluoromethyl)phenyl]sulfonylurea.
| Compound Name | 1-(N-carbamoylcarbamimidoyl)-3-[2-(trifluoromethyl)phenyl]sulfonylurea |
|---|---|
| PubChem CID | 165363604 |
| Molecular Formula | C20H20F6N10O8S2 |
| Molecular Weight | 706.56 g/mol |
| Exact Mass | 706.08 |
| IUPAC Name | 1-(N-carbamoylcarbamimidoyl)-3-[2-(trifluoromethyl)phenyl]sulfonylurea |
| SMILES | [H]/N=C(\NC(N)=O)NC(=O)NS(=O)(=O)c1ccccc1C(F)(F)F.[H]/N=C(\NC(N)=O)NC(=O)NS(=O)(=O)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/2C10H10F3N5O4S/c2*11-10(12,13)5-3-1-2-4-6(5)23(21,22)18-9(20)17-7(14)16-8(15)19/h2*1-4H,(H6,14,15,16,17,18,19,20) |
| InChIKey | DHHPOBXNYWXCPB-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 308.48 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.56 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|