C14H13F6N5O4S — CID 173492817
methyl N-(1-amino-2,2,2-trifluoroethylidene)-N'-[1-[[2-(trifluoromethyl)phenyl]sulfonylcarbamoylamino]ethenyl]carbamimidate (PubChem CID 173492817) has the molecular formula C14H13F6N5O4S and a molecular weight of 461.34 g/mol. Its IUPAC name is methyl N-(1-amino-2,2,2-trifluoroethylidene)-N'-[1-[[2-(trifluoromethyl)phenyl]sulfonylcarbamoylamino]ethenyl]carbamimidate.
| Compound Name | methyl N-(1-amino-2,2,2-trifluoroethylidene)-N'-[1-[[2-(trifluoromethyl)phenyl]sulfonylcarbamoylamino]ethenyl]carbamimidate |
|---|---|
| PubChem CID | 173492817 |
| Molecular Formula | C14H13F6N5O4S |
| Molecular Weight | 461.34 g/mol |
| Exact Mass | 461.06 |
| IUPAC Name | methyl N-(1-amino-2,2,2-trifluoroethylidene)-N'-[1-[[2-(trifluoromethyl)phenyl]sulfonylcarbamoylamino]ethenyl]carbamimidate |
| SMILES | C=C(N=C(N=C(N)C(F)(F)F)OC)NC(=O)NS(=O)(=O)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C14H13F6N5O4S/c1-7(23-12(29-2)24-10(21)14(18,19)20)22-11(26)25-30(27,28)9-6-4-3-5-8(9)13(15,16)17/h3-6H,1H2,2H3,(H2,21,23,24)(H2,22,25,26) |
| InChIKey | UQGQVHFOQVAHSN-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 135.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.34 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|