potassium 2,3,3,3-tetrafluoro-2-(trifluoromethyl)propanoate

C4F7KO2 — CID 23684023

IUPACpotassium 2,3,3,3-tetrafluoro-2-(trifluoromethyl)propanoate
SMILESO=C([O-])C(F)(C(F)(F)F)C(F)(F)F.[K+]
InChIInChI=1S/C4HF7O2.K/c5-2(1(12)13,3(6,7)8)4(9,10)11;/h(H,12,13);/q;+1/p-1
InChIKeySSRGSKSPRMHCLK-UHFFFAOYSA-M
MW252.13 g/mol
LogP-2.43
Rot. Bonds1

About potassium 2,3,3,3-tetrafluoro-2-(trifluoromethyl)propanoate

potassium 2,3,3,3-tetrafluoro-2-(trifluoromethyl)propanoate (PubChem CID 23684023) has the molecular formula C4F7KO2 and a molecular weight of 252.13 g/mol. Its IUPAC name is potassium 2,3,3,3-tetrafluoro-2-(trifluoromethyl)propanoate.

Molecular Properties

Compound Namepotassium 2,3,3,3-tetrafluoro-2-(trifluoromethyl)propanoate
PubChem CID23684023
Molecular FormulaC4F7KO2
Molecular Weight252.13 g/mol
Exact Mass251.94
IUPAC Namepotassium 2,3,3,3-tetrafluoro-2-(trifluoromethyl)propanoate
SMILESO=C([O-])C(F)(C(F)(F)F)C(F)(F)F.[K+]
InChIInChI=1S/C4HF7O2.K/c5-2(1(12)13,3(6,7)8)4(9,10)11;/h(H,12,13);/q;+1/p-1
InChIKeySSRGSKSPRMHCLK-UHFFFAOYSA-M
XLogP-2.43
TPSA40.13 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500252.13
LogP ≤ 5-2.43
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Analyze potassium 2,3,3,3-tetrafluoro-2-(trifluoromethyl)propanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of potassium 2,3,3,3-tetrafluoro-2-(trifluoromethyl)propanoate?
The IUPAC name of potassium 2,3,3,3-tetrafluoro-2-(trifluoromethyl)propanoate (CID 23684023) is potassium 2,3,3,3-tetrafluoro-2-(trifluoromethyl)propanoate.
What is the SMILES notation for potassium 2,3,3,3-tetrafluoro-2-(trifluoromethyl)propanoate?
The canonical SMILES for potassium 2,3,3,3-tetrafluoro-2-(trifluoromethyl)propanoate is O=C([O-])C(F)(C(F)(F)F)C(F)(F)F.[K+].
What is the InChIKey of potassium 2,3,3,3-tetrafluoro-2-(trifluoromethyl)propanoate?
The InChIKey is SSRGSKSPRMHCLK-UHFFFAOYSA-M. The full InChI is InChI=1S/C4HF7O2.K/c5-2(1(12)13,3(6,7)8)4(9,10)11;/h(H,12,13);/q;+1/p-1.
What are the key properties of potassium 2,3,3,3-tetrafluoro-2-(trifluoromethyl)propanoate?
potassium 2,3,3,3-tetrafluoro-2-(trifluoromethyl)propanoate has a molecular weight of 252.13 g/mol, XLogP of -2.43, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for potassium 2,3,3,3-tetrafluoro-2-(trifluoromethyl)propanoate is sourced from PubChem (CID 23684023), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).