C6F12KNO2 — CID 4271848
potassium 2-[[bis(trifluoromethyl)amino]-difluoromethyl]-2,3,3,3-tetrafluoropropanoate (PubChem CID 4271848) has the molecular formula C6F12KNO2 and a molecular weight of 385.15 g/mol. Its IUPAC name is potassium 2-[[bis(trifluoromethyl)amino]-difluoromethyl]-2,3,3,3-tetrafluoropropanoate.
| Compound Name | potassium 2-[[bis(trifluoromethyl)amino]-difluoromethyl]-2,3,3,3-tetrafluoropropanoate |
|---|---|
| PubChem CID | 4271848 |
| Molecular Formula | C6F12KNO2 |
| Molecular Weight | 385.15 g/mol |
| Exact Mass | 384.94 |
| IUPAC Name | potassium 2-[[bis(trifluoromethyl)amino]-difluoromethyl]-2,3,3,3-tetrafluoropropanoate |
| SMILES | O=C([O-])C(F)(C(F)(F)F)C(F)(F)N(C(F)(F)F)C(F)(F)F.[K+] |
| InChI | InChI=1S/C6HF12NO2.K/c7-2(1(20)21,3(8,9)10)4(11,12)19(5(13,14)15)6(16,17)18;/h(H,20,21);/q;+1/p-1 |
| InChIKey | VGVFYLXSWXFQNE-UHFFFAOYSA-M |
| XLogP | -1.05 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.15 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|