C12F24N2O4 — CID 15219193
[2-[[bis(trifluoromethyl)amino]-difluoromethyl]-2,3,3,3-tetrafluoropropanoyl] 2-[[bis(trifluoromethyl)amino]-difluoromethyl]-2,3,3,3-tetrafluoropropaneperoxoate (PubChem CID 15219193) has the molecular formula C12F24N2O4 and a molecular weight of 692.09 g/mol. Its IUPAC name is [2-[[bis(trifluoromethyl)amino]-difluoromethyl]-2,3,3,3-tetrafluoropropanoyl] 2-[[bis(trifluoromethyl)amino]-difluoromethyl]-2,3,3,3-tetrafluoropropaneperoxoate.
| Compound Name | [2-[[bis(trifluoromethyl)amino]-difluoromethyl]-2,3,3,3-tetrafluoropropanoyl] 2-[[bis(trifluoromethyl)amino]-difluoromethyl]-2,3,3,3-tetrafluoropropaneperoxoate |
|---|---|
| PubChem CID | 15219193 |
| Molecular Formula | C12F24N2O4 |
| Molecular Weight | 692.09 g/mol |
| Exact Mass | 691.95 |
| IUPAC Name | [2-[[bis(trifluoromethyl)amino]-difluoromethyl]-2,3,3,3-tetrafluoropropanoyl] 2-[[bis(trifluoromethyl)amino]-difluoromethyl]-2,3,3,3-tetrafluoropropaneperoxoate |
| SMILES | O=C(OOC(=O)C(F)(C(F)(F)F)C(F)(F)N(C(F)(F)F)C(F)(F)F)C(F)(C(F)(F)F)C(F)(F)N(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12F24N2O4/c13-3(5(15,16)17,7(21,22)37(9(25,26)27)10(28,29)30)1(39)41-42-2(40)4(14,6(18,19)20)8(23,24)38(11(31,32)33)12(34,35)36 |
| InChIKey | RGIKFONGDLJXRK-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.09 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|