C6F13NO — CID 101034948
4-[bis(trifluoromethyl)amino]-2,2,3,3,4,4-hexafluorobutanoyl fluoride (PubChem CID 101034948) has the molecular formula C6F13NO and a molecular weight of 349.05 g/mol. Its IUPAC name is 4-[bis(trifluoromethyl)amino]-2,2,3,3,4,4-hexafluorobutanoyl fluoride.
| Compound Name | 4-[bis(trifluoromethyl)amino]-2,2,3,3,4,4-hexafluorobutanoyl fluoride |
|---|---|
| PubChem CID | 101034948 |
| Molecular Formula | C6F13NO |
| Molecular Weight | 349.05 g/mol |
| Exact Mass | 348.98 |
| IUPAC Name | 4-[bis(trifluoromethyl)amino]-2,2,3,3,4,4-hexafluorobutanoyl fluoride |
| SMILES | O=C(F)C(F)(F)C(F)(F)C(F)(F)N(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C6F13NO/c7-1(21)2(8,9)3(10,11)4(12,13)20(5(14,15)16)6(17,18)19 |
| InChIKey | IPDUKYVMXONQPD-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.05 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|