C12H4F24N2 — CID 71343779
1,1,2,2,3,3,4,4,5,5,6,6-dodecafluoro-N,N,N',N'-tetrakis(trifluoromethyl)octane-1,8-diamine (PubChem CID 71343779) has the molecular formula C12H4F24N2 and a molecular weight of 632.13 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,5,5,6,6-dodecafluoro-N,N,N',N'-tetrakis(trifluoromethyl)octane-1,8-diamine.
| Compound Name | 1,1,2,2,3,3,4,4,5,5,6,6-dodecafluoro-N,N,N',N'-tetrakis(trifluoromethyl)octane-1,8-diamine |
|---|---|
| PubChem CID | 71343779 |
| Molecular Formula | C12H4F24N2 |
| Molecular Weight | 632.13 g/mol |
| Exact Mass | 632.00 |
| IUPAC Name | 1,1,2,2,3,3,4,4,5,5,6,6-dodecafluoro-N,N,N',N'-tetrakis(trifluoromethyl)octane-1,8-diamine |
| SMILES | FC(F)(F)N(CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)N(C(F)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H4F24N2/c13-3(14,1-2-37(9(25,26)27)10(28,29)30)4(15,16)5(17,18)6(19,20)7(21,22)8(23,24)38(11(31,32)33)12(34,35)36/h1-2H2 |
| InChIKey | YWFHPEPXPRKHQS-UHFFFAOYSA-N |
| XLogP | 7.83 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.13 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|