C14H10F21N — CID 172565059
N-(3,3,4,4,5,5,6,6,7,7-decafluoroheptyl)-N,3,3,4,4,5,5,6,6,7,7-undecafluoroheptan-1-amine (PubChem CID 172565059) has the molecular formula C14H10F21N and a molecular weight of 591.20 g/mol. Its IUPAC name is N-(3,3,4,4,5,5,6,6,7,7-decafluoroheptyl)-N,3,3,4,4,5,5,6,6,7,7-undecafluoroheptan-1-amine.
| Compound Name | N-(3,3,4,4,5,5,6,6,7,7-decafluoroheptyl)-N,3,3,4,4,5,5,6,6,7,7-undecafluoroheptan-1-amine |
|---|---|
| PubChem CID | 172565059 |
| Molecular Formula | C14H10F21N |
| Molecular Weight | 591.20 g/mol |
| Exact Mass | 591.05 |
| IUPAC Name | N-(3,3,4,4,5,5,6,6,7,7-decafluoroheptyl)-N,3,3,4,4,5,5,6,6,7,7-undecafluoroheptan-1-amine |
| SMILES | FC(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CCN(F)CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C14H10F21N/c15-5(16)9(23,24)13(31,32)11(27,28)7(19,20)1-3-36(35)4-2-8(21,22)12(29,30)14(33,34)10(25,26)6(17)18/h5-6H,1-4H2 |
| InChIKey | MDLNLVGJUKPFAP-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.20 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|