C21H26F20O3 — CID 172565136
1,3-bis(3,3,4,4,5,5,6,6,7,7-decafluoroheptoxy)propan-2-ol;butane (PubChem CID 172565136) has the molecular formula C21H26F20O3 and a molecular weight of 706.40 g/mol. Its IUPAC name is 1,3-bis(3,3,4,4,5,5,6,6,7,7-decafluoroheptoxy)propan-2-ol;butane.
| Compound Name | 1,3-bis(3,3,4,4,5,5,6,6,7,7-decafluoroheptoxy)propan-2-ol;butane |
|---|---|
| PubChem CID | 172565136 |
| Molecular Formula | C21H26F20O3 |
| Molecular Weight | 706.40 g/mol |
| Exact Mass | 706.16 |
| IUPAC Name | 1,3-bis(3,3,4,4,5,5,6,6,7,7-decafluoroheptoxy)propan-2-ol;butane |
| SMILES | CCCC.OC(COCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F)COCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C17H16F20O3.C4H10/c18-8(19)12(26,27)16(34,35)14(30,31)10(22,23)1-3-39-5-7(38)6-40-4-2-11(24,25)15(32,33)17(36,37)13(28,29)9(20)21;1-3-4-2/h7-9,38H,1-6H2;3-4H2,1-2H3 |
| InChIKey | FCPQTSJXFDNENK-UHFFFAOYSA-N |
| XLogP | 8.58 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.40 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|