C9H13F7O3 — CID 175008468
1-(3,3,4,4,5,5,5-heptafluoropentoxy)butane-2,3-diol (PubChem CID 175008468) has the molecular formula C9H13F7O3 and a molecular weight of 302.19 g/mol. Its IUPAC name is 1-(3,3,4,4,5,5,5-heptafluoropentoxy)butane-2,3-diol.
| Compound Name | 1-(3,3,4,4,5,5,5-heptafluoropentoxy)butane-2,3-diol |
|---|---|
| PubChem CID | 175008468 |
| Molecular Formula | C9H13F7O3 |
| Molecular Weight | 302.19 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | 1-(3,3,4,4,5,5,5-heptafluoropentoxy)butane-2,3-diol |
| SMILES | CC(O)C(O)COCCC(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H13F7O3/c1-5(17)6(18)4-19-3-2-7(10,11)8(12,13)9(14,15)16/h5-6,17-18H,2-4H2,1H3 |
| InChIKey | WLEUTMVRMXUKCD-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.19 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|