C19H22F18I2O4 — CID 161308858
2-iodo-3-(4,4,5,5,6,6,7,7,7-nonafluoroheptoxy)propan-1-ol;2-iodo-3-(3,3,4,4,5,5,6,6,6-nonafluorohexoxy)propan-1-ol (PubChem CID 161308858) has the molecular formula C19H22F18I2O4 and a molecular weight of 910.15 g/mol. Its IUPAC name is 2-iodo-3-(4,4,5,5,6,6,7,7,7-nonafluoroheptoxy)propan-1-ol;2-iodo-3-(3,3,4,4,5,5,6,6,6-nonafluorohexoxy)propan-1-ol.
| Compound Name | 2-iodo-3-(4,4,5,5,6,6,7,7,7-nonafluoroheptoxy)propan-1-ol;2-iodo-3-(3,3,4,4,5,5,6,6,6-nonafluorohexoxy)propan-1-ol |
|---|---|
| PubChem CID | 161308858 |
| Molecular Formula | C19H22F18I2O4 |
| Molecular Weight | 910.15 g/mol |
| Exact Mass | 909.93 |
| IUPAC Name | 2-iodo-3-(4,4,5,5,6,6,7,7,7-nonafluoroheptoxy)propan-1-ol;2-iodo-3-(3,3,4,4,5,5,6,6,6-nonafluorohexoxy)propan-1-ol |
| SMILES | OCC(I)COCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F.OCC(I)COCCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H12F9IO2.C9H10F9IO2/c11-7(12,2-1-3-22-5-6(20)4-21)8(13,14)9(15,16)10(17,18)19;10-6(11,1-2-21-4-5(19)3-20)7(12,13)8(14,15)9(16,17)18/h6,21H,1-5H2;5,20H,1-4H2 |
| InChIKey | VIPRRJKGBRWAFA-UHFFFAOYSA-N |
| XLogP | 7.70 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 910.15 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|