C13H17F13N2O — CID 19043786
2-methyl-4-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctoxy)butane-1,3-diamine (PubChem CID 19043786) has the molecular formula C13H17F13N2O and a molecular weight of 464.27 g/mol. Its IUPAC name is 2-methyl-4-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctoxy)butane-1,3-diamine.
| Compound Name | 2-methyl-4-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctoxy)butane-1,3-diamine |
|---|---|
| PubChem CID | 19043786 |
| Molecular Formula | C13H17F13N2O |
| Molecular Weight | 464.27 g/mol |
| Exact Mass | 464.11 |
| IUPAC Name | 2-methyl-4-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctoxy)butane-1,3-diamine |
| SMILES | CC(CN)C(N)COCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C13H17F13N2O/c1-6(4-27)7(28)5-29-3-2-8(14,15)9(16,17)10(18,19)11(20,21)12(22,23)13(24,25)26/h6-7H,2-5,27-28H2,1H3 |
| InChIKey | GONOLDVCMBHGQV-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.27 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|