C12H17F9O3 — CID 142737821
1-butoxy-3-(2,2,3,3,4,4,5,5,5-nonafluoropentoxy)propan-2-ol (PubChem CID 142737821) has the molecular formula C12H17F9O3 and a molecular weight of 380.25 g/mol. Its IUPAC name is 1-butoxy-3-(2,2,3,3,4,4,5,5,5-nonafluoropentoxy)propan-2-ol.
| Compound Name | 1-butoxy-3-(2,2,3,3,4,4,5,5,5-nonafluoropentoxy)propan-2-ol |
|---|---|
| PubChem CID | 142737821 |
| Molecular Formula | C12H17F9O3 |
| Molecular Weight | 380.25 g/mol |
| Exact Mass | 380.10 |
| IUPAC Name | 1-butoxy-3-(2,2,3,3,4,4,5,5,5-nonafluoropentoxy)propan-2-ol |
| SMILES | CCCCOCC(O)COCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H17F9O3/c1-2-3-4-23-5-8(22)6-24-7-9(13,14)10(15,16)11(17,18)12(19,20)21/h8,22H,2-7H2,1H3 |
| InChIKey | OCPCJZYDQLANKL-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.25 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|