C16H16Cl2F17NO2 — CID 10722880
1-chloro-3-[(3-chloro-2-hydroxypropyl)-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl)amino]propan-2-ol (PubChem CID 10722880) has the molecular formula C16H16Cl2F17NO2 and a molecular weight of 648.18 g/mol. Its IUPAC name is 1-chloro-3-[(3-chloro-2-hydroxypropyl)-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl)amino]propan-2-ol.
| Compound Name | 1-chloro-3-[(3-chloro-2-hydroxypropyl)-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl)amino]propan-2-ol |
|---|---|
| PubChem CID | 10722880 |
| Molecular Formula | C16H16Cl2F17NO2 |
| Molecular Weight | 648.18 g/mol |
| Exact Mass | 647.03 |
| IUPAC Name | 1-chloro-3-[(3-chloro-2-hydroxypropyl)-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl)amino]propan-2-ol |
| SMILES | OC(CCl)CN(CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)CC(O)CCl |
| InChI | InChI=1S/C16H16Cl2F17NO2/c17-3-7(37)5-36(6-8(38)4-18)2-1-9(19,20)10(21,22)11(23,24)12(25,26)13(27,28)14(29,30)15(31,32)16(33,34)35/h7-8,37-38H,1-6H2 |
| InChIKey | GHCSAUFGIZWUHB-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.18 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|