C4Cl2F4MgO4 — CID 87738116
magnesium bis(2-chloro-2,2-difluoroacetate) (PubChem CID 87738116) has the molecular formula C4Cl2F4MgO4 and a molecular weight of 283.24 g/mol. Its IUPAC name is magnesium bis(2-chloro-2,2-difluoroacetate).
| Compound Name | magnesium bis(2-chloro-2,2-difluoroacetate) |
|---|---|
| PubChem CID | 87738116 |
| Molecular Formula | C4Cl2F4MgO4 |
| Molecular Weight | 283.24 g/mol |
| Exact Mass | 281.90 |
| IUPAC Name | magnesium bis(2-chloro-2,2-difluoroacetate) |
| SMILES | O=C([O-])C(F)(F)Cl.O=C([O-])C(F)(F)Cl.[Mg+2] |
| InChI | InChI=1S/2C2HClF2O2.Mg/c2*3-2(4,5)1(6)7;/h2*(H,6,7);/q;;+2/p-2 |
| InChIKey | VQJXAYDKZFFGBP-UHFFFAOYSA-L |
| XLogP | -1.25 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.24 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|