C4Cl6O4Sr — CID 161000929
strontium bis(2,2,2-trichloroacetate) (PubChem CID 161000929) has the molecular formula C4Cl6O4Sr and a molecular weight of 412.38 g/mol. Its IUPAC name is strontium bis(2,2,2-trichloroacetate).
| Compound Name | strontium bis(2,2,2-trichloroacetate) |
|---|---|
| PubChem CID | 161000929 |
| Molecular Formula | C4Cl6O4Sr |
| Molecular Weight | 412.38 g/mol |
| Exact Mass | 409.70 |
| IUPAC Name | strontium bis(2,2,2-trichloroacetate) |
| SMILES | O=C([O-])C(Cl)(Cl)Cl.O=C([O-])C(Cl)(Cl)Cl.[Sr+2] |
| InChI | InChI=1S/2C2HCl3O2.Sr/c2*3-2(4,5)1(6)7;/h2*(H,6,7);/q;;+2/p-2 |
| InChIKey | TVWCXFFCLCXHDQ-UHFFFAOYSA-L |
| XLogP | -0.17 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.38 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|