About 2,2,2-trichloroacetate acetate
2,2,2-trichloroacetate acetate (PubChem CID 22770169) has the molecular formula C4H3Cl3O4-2
and a molecular weight of 221.42 g/mol. Its IUPAC name is 2,2,2-trichloroacetate acetate.
Molecular Properties
| Compound Name | 2,2,2-trichloroacetate acetate |
| PubChem CID | 22770169 |
| Molecular Formula | C4H3Cl3O4-2 |
| Molecular Weight | 221.42 g/mol |
| Exact Mass | 219.91 |
| IUPAC Name | 2,2,2-trichloroacetate acetate |
| SMILES | CC(=O)[O-].O=C([O-])C(Cl)(Cl)Cl |
| InChI | InChI=1S/C2HCl3O2.C2H4O2/c3-2(4,5)1(6)7;1-2(3)4/h(H,6,7);1H3,(H,3,4)/p-2 |
| InChIKey | VGSOUDGIYSVAEU-UHFFFAOYSA-L |
| XLogP | -1.14 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.42 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2,2,2-trichloroacetate acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2,2-trichloroacetate acetate?
The IUPAC name of 2,2,2-trichloroacetate acetate (CID 22770169) is 2,2,2-trichloroacetate acetate.
What is the SMILES notation for 2,2,2-trichloroacetate acetate?
The canonical SMILES for 2,2,2-trichloroacetate acetate is CC(=O)[O-].O=C([O-])C(Cl)(Cl)Cl.
What is the InChIKey of 2,2,2-trichloroacetate acetate?
The InChIKey is VGSOUDGIYSVAEU-UHFFFAOYSA-L. The full InChI is InChI=1S/C2HCl3O2.C2H4O2/c3-2(4,5)1(6)7;1-2(3)4/h(H,6,7);1H3,(H,3,4)/p-2.
What are the key properties of 2,2,2-trichloroacetate acetate?
2,2,2-trichloroacetate acetate has a molecular weight of 221.42 g/mol, XLogP of -1.14, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2,2-trichloroacetate acetate is sourced from PubChem (CID 22770169), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).