C12H19Cl3NiO4 — CID 22002704
decanoate;nickel(2+);2,2,2-trichloroacetate (PubChem CID 22002704) has the molecular formula C12H19Cl3NiO4 and a molecular weight of 392.33 g/mol. Its IUPAC name is decanoate;nickel(2+);2,2,2-trichloroacetate.
| Compound Name | decanoate;nickel(2+);2,2,2-trichloroacetate |
|---|---|
| PubChem CID | 22002704 |
| Molecular Formula | C12H19Cl3NiO4 |
| Molecular Weight | 392.33 g/mol |
| Exact Mass | 389.97 |
| IUPAC Name | decanoate;nickel(2+);2,2,2-trichloroacetate |
| SMILES | CCCCCCCCCC(=O)[O-].O=C([O-])C(Cl)(Cl)Cl.[Ni+2] |
| InChI | InChI=1S/C10H20O2.C2HCl3O2.Ni/c1-2-3-4-5-6-7-8-9-10(11)12;3-2(4,5)1(6)7;/h2-9H2,1H3,(H,11,12);(H,6,7);/q;;+2/p-2 |
| InChIKey | YMUXTOSXZZKDQR-UHFFFAOYSA-L |
| XLogP | 1.98 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.33 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|