C11H2F19NO4S — CID 173204832
4,4,5,5,5-pentafluoro-3-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonylamino)-2-(1,1,2,2,2-pentafluoroethyl)pent-2-enoic acid (PubChem CID 173204832) has the molecular formula C11H2F19NO4S and a molecular weight of 605.17 g/mol. Its IUPAC name is 4,4,5,5,5-pentafluoro-3-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonylamino)-2-(1,1,2,2,2-pentafluoroethyl)pent-2-enoic acid.
| Compound Name | 4,4,5,5,5-pentafluoro-3-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonylamino)-2-(1,1,2,2,2-pentafluoroethyl)pent-2-enoic acid |
|---|---|
| PubChem CID | 173204832 |
| Molecular Formula | C11H2F19NO4S |
| Molecular Weight | 605.17 g/mol |
| Exact Mass | 604.94 |
| IUPAC Name | 4,4,5,5,5-pentafluoro-3-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonylamino)-2-(1,1,2,2,2-pentafluoroethyl)pent-2-enoic acid |
| SMILES | O=C(O)C(=C(NS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H2F19NO4S/c12-4(13,8(20,21)22)1(3(32)33)2(5(14,15)9(23,24)25)31-36(34,35)11(29,30)7(18,19)6(16,17)10(26,27)28/h31H,(H,32,33) |
| InChIKey | ZFFMNNKTKAUXCT-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.17 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|