C10H5F9N2O3S — CID 122628420
N-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)pyridine-2-carboxamide (PubChem CID 122628420) has the molecular formula C10H5F9N2O3S and a molecular weight of 404.21 g/mol. Its IUPAC name is N-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)pyridine-2-carboxamide.
| Compound Name | N-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 122628420 |
| Molecular Formula | C10H5F9N2O3S |
| Molecular Weight | 404.21 g/mol |
| Exact Mass | 403.99 |
| IUPAC Name | N-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)pyridine-2-carboxamide |
| SMILES | O=C(NS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c1ccccn1 |
| InChI | InChI=1S/C10H5F9N2O3S/c11-7(12,9(15,16)17)8(13,14)10(18,19)25(23,24)21-6(22)5-3-1-2-4-20-5/h1-4H,(H,21,22) |
| InChIKey | DZDCRFDDELMLES-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.21 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|