C11H10F6N2O5 — CID 172678259
N-methylpyridine-2-carboxamide;bis(2,2,2-trifluoroacetic acid) (PubChem CID 172678259) has the molecular formula C11H10F6N2O5 and a molecular weight of 364.20 g/mol. Its IUPAC name is N-methylpyridine-2-carboxamide;bis(2,2,2-trifluoroacetic acid).
| Compound Name | N-methylpyridine-2-carboxamide;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 172678259 |
| Molecular Formula | C11H10F6N2O5 |
| Molecular Weight | 364.20 g/mol |
| Exact Mass | 364.05 |
| IUPAC Name | N-methylpyridine-2-carboxamide;bis(2,2,2-trifluoroacetic acid) |
| SMILES | CNC(=O)c1ccccn1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C7H8N2O.2C2HF3O2/c1-8-7(10)6-4-2-3-5-9-6;2*3-2(4,5)1(6)7/h2-5H,1H3,(H,8,10);2*(H,6,7) |
| InChIKey | AAPHOBGEHCTAHW-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 116.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.20 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |