C8H8F3N3O2 — CID 161312588
pyridine-2-carboximidamide;2,2,2-trifluoroacetic acid (PubChem CID 161312588) has the molecular formula C8H8F3N3O2 and a molecular weight of 235.17 g/mol. Its IUPAC name is pyridine-2-carboximidamide;2,2,2-trifluoroacetic acid.
| Compound Name | pyridine-2-carboximidamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 161312588 |
| Molecular Formula | C8H8F3N3O2 |
| Molecular Weight | 235.17 g/mol |
| Exact Mass | 235.06 |
| IUPAC Name | pyridine-2-carboximidamide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.[H]/N=C(\N)c1ccccn1 |
| InChI | InChI=1S/C6H7N3.C2HF3O2/c7-6(8)5-3-1-2-4-9-5;3-2(4,5)1(6)7/h1-4H,(H3,7,8);(H,6,7) |
| InChIKey | VJBWAKTUJKTYRA-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 100.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.17 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|