C4H7ClF3NO4S — CID 88792540
1-[(2,2,2-trifluoroacetyl)amino]ethanesulfonic acid;hydrochloride (PubChem CID 88792540) has the molecular formula C4H7ClF3NO4S and a molecular weight of 257.62 g/mol. Its IUPAC name is 1-[(2,2,2-trifluoroacetyl)amino]ethanesulfonic acid;hydrochloride.
| Compound Name | 1-[(2,2,2-trifluoroacetyl)amino]ethanesulfonic acid;hydrochloride |
|---|---|
| PubChem CID | 88792540 |
| Molecular Formula | C4H7ClF3NO4S |
| Molecular Weight | 257.62 g/mol |
| Exact Mass | 256.97 |
| IUPAC Name | 1-[(2,2,2-trifluoroacetyl)amino]ethanesulfonic acid;hydrochloride |
| SMILES | CC(NC(=O)C(F)(F)F)S(=O)(=O)O.Cl |
| InChI | InChI=1S/C4H6F3NO4S.ClH/c1-2(13(10,11)12)8-3(9)4(5,6)7;/h2H,1H3,(H,8,9)(H,10,11,12);1H |
| InChIKey | WENWHJUILJKOLA-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.62 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|