C22H32N3O6+ — CID 19852953
(2-hydroxy-3-naphthalen-1-yloxypropyl)-dimethyl-[3-(4-nitrooxybutanoylamino)propyl]azanium (PubChem CID 19852953) has the molecular formula C22H32N3O6+ and a molecular weight of 434.51 g/mol. Its IUPAC name is (2-hydroxy-3-naphthalen-1-yloxypropyl)-dimethyl-[3-(4-nitrooxybutanoylamino)propyl]azanium.
| Compound Name | (2-hydroxy-3-naphthalen-1-yloxypropyl)-dimethyl-[3-(4-nitrooxybutanoylamino)propyl]azanium |
|---|---|
| PubChem CID | 19852953 |
| Molecular Formula | C22H32N3O6+ |
| Molecular Weight | 434.51 g/mol |
| Exact Mass | 434.23 |
| IUPAC Name | (2-hydroxy-3-naphthalen-1-yloxypropyl)-dimethyl-[3-(4-nitrooxybutanoylamino)propyl]azanium |
| SMILES | C[N+](C)(CCCNC(=O)CCCO[N+](=O)[O-])CC(O)COc1cccc2ccccc12 |
| InChI | InChI=1S/C22H31N3O6/c1-25(2,14-7-13-23-22(27)12-6-15-31-24(28)29)16-19(26)17-30-21-11-5-9-18-8-3-4-10-20(18)21/h3-5,8-11,19,26H,6-7,12-17H2,1-2H3/p+1 |
| InChIKey | LSWDBMOPXXOWBD-UHFFFAOYSA-O |
| XLogP | 2.15 |
| TPSA | 110.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.51 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|