C23H26ClN2O3+ — CID 7033877
[2-(2-chloroanilino)-2-oxoethyl]-[(2R)-2-hydroxy-3-naphthalen-1-yloxypropyl]-dimethylazanium (PubChem CID 7033877) has the molecular formula C23H26ClN2O3+ and a molecular weight of 413.93 g/mol. Its IUPAC name is [2-(2-chloroanilino)-2-oxoethyl]-[(2R)-2-hydroxy-3-naphthalen-1-yloxypropyl]-dimethylazanium.
| Compound Name | [2-(2-chloroanilino)-2-oxoethyl]-[(2R)-2-hydroxy-3-naphthalen-1-yloxypropyl]-dimethylazanium |
|---|---|
| PubChem CID | 7033877 |
| Molecular Formula | C23H26ClN2O3+ |
| Molecular Weight | 413.93 g/mol |
| Exact Mass | 413.16 |
| IUPAC Name | [2-(2-chloroanilino)-2-oxoethyl]-[(2R)-2-hydroxy-3-naphthalen-1-yloxypropyl]-dimethylazanium |
| SMILES | C[N+](C)(CC(=O)Nc1ccccc1Cl)C[C@@H](O)COc1cccc2ccccc12 |
| InChI | InChI=1S/C23H25ClN2O3/c1-26(2,15-23(28)25-21-12-6-5-11-20(21)24)14-18(27)16-29-22-13-7-9-17-8-3-4-10-19(17)22/h3-13,18,27H,14-16H2,1-2H3/p+1/t18-/m1/s1 |
| InChIKey | XWWMXAFWBFRBEX-GOSISDBHSA-O |
| XLogP | 3.95 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.93 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|