C25H30N2O3 — CID 54400739
4-[(2-hydroxy-3-naphthalen-1-yloxypropyl)amino]-N-(4-methylphenyl)pentanamide (PubChem CID 54400739) has the molecular formula C25H30N2O3 and a molecular weight of 406.53 g/mol. Its IUPAC name is 4-[(2-hydroxy-3-naphthalen-1-yloxypropyl)amino]-N-(4-methylphenyl)pentanamide.
| Compound Name | 4-[(2-hydroxy-3-naphthalen-1-yloxypropyl)amino]-N-(4-methylphenyl)pentanamide |
|---|---|
| PubChem CID | 54400739 |
| Molecular Formula | C25H30N2O3 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.23 |
| IUPAC Name | 4-[(2-hydroxy-3-naphthalen-1-yloxypropyl)amino]-N-(4-methylphenyl)pentanamide |
| SMILES | Cc1ccc(NC(=O)CCC(C)NCC(O)COc2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C25H30N2O3/c1-18-10-13-21(14-11-18)27-25(29)15-12-19(2)26-16-22(28)17-30-24-9-5-7-20-6-3-4-8-23(20)24/h3-11,13-14,19,22,26,28H,12,15-17H2,1-2H3,(H,27,29) |
| InChIKey | VNGGYSQCGCPOQH-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |