C18H26N4O7 — CID 70380600
[4-[2-[[2-hydroxy-3-[[2-(hydroxymethyl)-1H-indol-4-yl]oxy]propyl]amino]ethylamino]-4-oxobutyl] nitrate (PubChem CID 70380600) has the molecular formula C18H26N4O7 and a molecular weight of 410.43 g/mol. Its IUPAC name is [4-[2-[[2-hydroxy-3-[[2-(hydroxymethyl)-1H-indol-4-yl]oxy]propyl]amino]ethylamino]-4-oxobutyl] nitrate.
| Compound Name | [4-[2-[[2-hydroxy-3-[[2-(hydroxymethyl)-1H-indol-4-yl]oxy]propyl]amino]ethylamino]-4-oxobutyl] nitrate |
|---|---|
| PubChem CID | 70380600 |
| Molecular Formula | C18H26N4O7 |
| Molecular Weight | 410.43 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | [4-[2-[[2-hydroxy-3-[[2-(hydroxymethyl)-1H-indol-4-yl]oxy]propyl]amino]ethylamino]-4-oxobutyl] nitrate |
| SMILES | O=C(CCCO[N+](=O)[O-])NCCNCC(O)COc1cccc2[nH]c(CO)cc12 |
| InChI | InChI=1S/C18H26N4O7/c23-11-13-9-15-16(21-13)3-1-4-17(15)28-12-14(24)10-19-6-7-20-18(25)5-2-8-29-22(26)27/h1,3-4,9,14,19,21,23-24H,2,5-8,10-12H2,(H,20,25) |
| InChIKey | KKJJJCBPAXTQOG-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 158.98 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.43 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|